C11H7FN2O4 — CID 63189912
3-fluoro-4-(1,2-oxazole-5-carbonylamino)benzoic acid (PubChem CID 63189912) has the molecular formula C11H7FN2O4 and a molecular weight of 250.19 g/mol. Its IUPAC name is 3-fluoro-4-(1,2-oxazole-5-carbonylamino)benzoic acid.
| Compound Name | 3-fluoro-4-(1,2-oxazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63189912 |
| Molecular Formula | C11H7FN2O4 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3-fluoro-4-(1,2-oxazole-5-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccno2)c(F)c1 |
| InChI | InChI=1S/C11H7FN2O4/c12-7-5-6(11(16)17)1-2-8(7)14-10(15)9-3-4-13-18-9/h1-5H,(H,14,15)(H,16,17) |
| InChIKey | BDSJRARRUKLVLQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |