C12H8N2O6 — CID 60845787
5-(1,2-oxazole-5-carbonylamino)benzene-1,3-dicarboxylic acid (PubChem CID 60845787) has the molecular formula C12H8N2O6 and a molecular weight of 276.20 g/mol. Its IUPAC name is 5-(1,2-oxazole-5-carbonylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(1,2-oxazole-5-carbonylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 60845787 |
| Molecular Formula | C12H8N2O6 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 5-(1,2-oxazole-5-carbonylamino)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2ccno2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H8N2O6/c15-10(9-1-2-13-20-9)14-8-4-6(11(16)17)3-7(5-8)12(18)19/h1-5H,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | SEZPPCGDTWNEBG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |