C10H6F2N2O2 — CID 110693698
N-(3,4-difluorophenyl)-1,2-oxazole-5-carboxamide (PubChem CID 110693698) has the molecular formula C10H6F2N2O2 and a molecular weight of 224.17 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110693698 |
| Molecular Formula | C10H6F2N2O2 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N-(3,4-difluorophenyl)-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccno1 |
| InChI | InChI=1S/C10H6F2N2O2/c11-7-2-1-6(5-8(7)12)14-10(15)9-3-4-13-16-9/h1-5H,(H,14,15) |
| InChIKey | KSDUEYAHQYXGSU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |