C12H7F3N2O — CID 61295443
N-(3,4-difluorophenyl)-2-fluoropyridine-4-carboxamide (PubChem CID 61295443) has the molecular formula C12H7F3N2O and a molecular weight of 252.20 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-fluoropyridine-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 61295443 |
| Molecular Formula | C12H7F3N2O |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccnc(F)c1 |
| InChI | InChI=1S/C12H7F3N2O/c13-9-2-1-8(6-10(9)14)17-12(18)7-3-4-16-11(15)5-7/h1-6H,(H,17,18) |
| InChIKey | LSSRRSPWCTXTMO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|