C15H11FN2O2 — CID 159000528
2-fluoro-N-(2-oxo-1,3-dihydroinden-5-yl)pyridine-4-carboxamide (PubChem CID 159000528) has the molecular formula C15H11FN2O2 and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-fluoro-N-(2-oxo-1,3-dihydroinden-5-yl)pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-(2-oxo-1,3-dihydroinden-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 159000528 |
| Molecular Formula | C15H11FN2O2 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-fluoro-N-(2-oxo-1,3-dihydroinden-5-yl)pyridine-4-carboxamide |
| SMILES | O=C1Cc2ccc(NC(=O)c3ccnc(F)c3)cc2C1 |
| InChI | InChI=1S/C15H11FN2O2/c16-14-8-10(3-4-17-14)15(20)18-12-2-1-9-6-13(19)7-11(9)5-12/h1-5,8H,6-7H2,(H,18,20) |
| InChIKey | JRHAZJBDSAPRJG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|