C15H15FN2O3 — CID 61295120
2-fluoro-N-[4-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide (PubChem CID 61295120) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-fluoro-N-[4-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-[4-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 61295120 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-fluoro-N-[4-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2ccnc(F)c2)cc1 |
| InChI | InChI=1S/C15H15FN2O3/c1-20-8-9-21-13-4-2-12(3-5-13)18-15(19)11-6-7-17-14(16)10-11/h2-7,10H,8-9H2,1H3,(H,18,19) |
| InChIKey | SMTSKDUMPUXTCI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|