C13H7ClF4N2O — CID 61295455
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-fluoropyridine-4-carboxamide (PubChem CID 61295455) has the molecular formula C13H7ClF4N2O and a molecular weight of 318.66 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 61295455 |
| Molecular Formula | C13H7ClF4N2O |
| Molecular Weight | 318.66 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccnc(F)c1 |
| InChI | InChI=1S/C13H7ClF4N2O/c14-10-2-1-8(6-9(10)13(16,17)18)20-12(21)7-3-4-19-11(15)5-7/h1-6H,(H,20,21) |
| InChIKey | XWFSWNKPPCAHQC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|