C17H10ClF3N2O — CID 142343699
N-[4-chloro-3-(trifluoromethyl)phenyl]quinoline-7-carboxamide (PubChem CID 142343699) has the molecular formula C17H10ClF3N2O and a molecular weight of 350.73 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]quinoline-7-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 142343699 |
| Molecular Formula | C17H10ClF3N2O |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]quinoline-7-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C17H10ClF3N2O/c18-14-6-5-12(9-13(14)17(19,20)21)23-16(24)11-4-3-10-2-1-7-22-15(10)8-11/h1-9H,(H,23,24) |
| InChIKey | ZPDWODCAFIRJFW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |