C19H12F3N3O2 — CID 109093279
2-N-(3,4-difluorophenyl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109093279) has the molecular formula C19H12F3N3O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is 2-N-(3,4-difluorophenyl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3,4-difluorophenyl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109093279 |
| Molecular Formula | C19H12F3N3O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-N-(3,4-difluorophenyl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccnc(C(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H12F3N3O2/c20-12-2-1-3-13(9-12)24-18(26)11-6-7-23-17(8-11)19(27)25-14-4-5-15(21)16(22)10-14/h1-10H,(H,24,26)(H,25,27) |
| InChIKey | WAGNNRQHTLZFTM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |