2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid

C12H10N2O5 — CID 55148878

IUPAC2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid
SMILESO=C(O)COc1cccc(NC(=O)c2ccno2)c1
InChIInChI=1S/C12H10N2O5/c15-11(16)7-18-9-3-1-2-8(6-9)14-12(17)10-4-5-13-19-10/h1-6H,7H2,(H,14,17)(H,15,16)
InChIKeyIJDBCPTVJZLDLT-UHFFFAOYSA-N
MW262.22 g/mol
LogP1.39
Rot. Bonds5

About 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid

2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid (PubChem CID 55148878) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid
PubChem CID55148878
Molecular FormulaC12H10N2O5
Molecular Weight262.22 g/mol
Exact Mass262.06
IUPAC Name2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid
SMILESO=C(O)COc1cccc(NC(=O)c2ccno2)c1
InChIInChI=1S/C12H10N2O5/c15-11(16)7-18-9-3-1-2-8(6-9)14-12(17)10-4-5-13-19-10/h1-6H,7H2,(H,14,17)(H,15,16)
InChIKeyIJDBCPTVJZLDLT-UHFFFAOYSA-N
XLogP1.39
TPSA101.66 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.22
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid?
The IUPAC name of 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid (CID 55148878) is 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid.
What is the SMILES notation for 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid?
The canonical SMILES for 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid is O=C(O)COc1cccc(NC(=O)c2ccno2)c1.
What is the InChIKey of 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid?
The InChIKey is IJDBCPTVJZLDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O5/c15-11(16)7-18-9-3-1-2-8(6-9)14-12(17)10-4-5-13-19-10/h1-6H,7H2,(H,14,17)(H,15,16).
What are the key properties of 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid?
2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid has a molecular weight of 262.22 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetic acid is sourced from PubChem (CID 55148878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).