C13H12N2O5 — CID 61057722
methyl 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetate (PubChem CID 61057722) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is methyl 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetate.
| Compound Name | methyl 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 61057722 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | methyl 2-[3-(1,2-oxazole-5-carbonylamino)phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(NC(=O)c2ccno2)c1 |
| InChI | InChI=1S/C13H12N2O5/c1-18-12(16)8-19-10-4-2-3-9(7-10)15-13(17)11-5-6-14-20-11/h2-7H,8H2,1H3,(H,15,17) |
| InChIKey | SMJRYXJGCPAZKJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |