C11H9N3O4S — CID 61058223
2-[3-(thiadiazole-5-carbonylamino)phenoxy]acetic acid (PubChem CID 61058223) has the molecular formula C11H9N3O4S and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-[3-(thiadiazole-5-carbonylamino)phenoxy]acetic acid.
| Compound Name | 2-[3-(thiadiazole-5-carbonylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 61058223 |
| Molecular Formula | C11H9N3O4S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-[3-(thiadiazole-5-carbonylamino)phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(NC(=O)c2cnns2)c1 |
| InChI | InChI=1S/C11H9N3O4S/c15-10(16)6-18-8-3-1-2-7(4-8)13-11(17)9-5-12-14-19-9/h1-5H,6H2,(H,13,17)(H,15,16) |
| InChIKey | KVQATOSBPXUXTR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |