C14H13NO5 — CID 61058593
2-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]acetic acid (PubChem CID 61058593) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]acetic acid.
| Compound Name | 2-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 61058593 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]acetic acid |
| SMILES | Cc1ccoc1C(=O)Nc1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C14H13NO5/c1-9-5-6-19-13(9)14(18)15-10-3-2-4-11(7-10)20-8-12(16)17/h2-7H,8H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | PREGKQOCHWGEIV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |