C15H15N3O5S — CID 119257780
3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]-5-methylsulfonylbenzoic acid (PubChem CID 119257780) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 119257780 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]-5-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1cc(NC(=O)c2cc(C3CC3)[nH]n2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H15N3O5S/c1-24(22,23)11-5-9(15(20)21)4-10(6-11)16-14(19)13-7-12(17-18-13)8-2-3-8/h4-8H,2-3H2,1H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | ZWIZPTZYDKNVSP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |