C15H19NO7S2 — CID 119257853
3-[(2-cyclopentylsulfonylacetyl)amino]-5-methylsulfonylbenzoic acid (PubChem CID 119257853) has the molecular formula C15H19NO7S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 3-[(2-cyclopentylsulfonylacetyl)amino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[(2-cyclopentylsulfonylacetyl)amino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 119257853 |
| Molecular Formula | C15H19NO7S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3-[(2-cyclopentylsulfonylacetyl)amino]-5-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1cc(NC(=O)CS(=O)(=O)C2CCCC2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H19NO7S2/c1-24(20,21)13-7-10(15(18)19)6-11(8-13)16-14(17)9-25(22,23)12-4-2-3-5-12/h6-8,12H,2-5,9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | AOURZFJAJUDIFX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |