C12H14BrNO5S — CID 91369398
3-(4-bromobutanoylamino)-5-methylsulfonylbenzoic acid (PubChem CID 91369398) has the molecular formula C12H14BrNO5S and a molecular weight of 364.22 g/mol. Its IUPAC name is 3-(4-bromobutanoylamino)-5-methylsulfonylbenzoic acid.
| Compound Name | 3-(4-bromobutanoylamino)-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 91369398 |
| Molecular Formula | C12H14BrNO5S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 3-(4-bromobutanoylamino)-5-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1cc(NC(=O)CCCBr)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H14BrNO5S/c1-20(18,19)10-6-8(12(16)17)5-9(7-10)14-11(15)3-2-4-13/h5-7H,2-4H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | GQOSEMKTROBYLD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|