C19H21NO5S — CID 119257783
3-[3-(2,4-dimethylphenyl)propanoylamino]-5-methylsulfonylbenzoic acid (PubChem CID 119257783) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-[3-(2,4-dimethylphenyl)propanoylamino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[3-(2,4-dimethylphenyl)propanoylamino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 119257783 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-[3-(2,4-dimethylphenyl)propanoylamino]-5-methylsulfonylbenzoic acid |
| SMILES | Cc1ccc(CCC(=O)Nc2cc(C(=O)O)cc(S(C)(=O)=O)c2)c(C)c1 |
| InChI | InChI=1S/C19H21NO5S/c1-12-4-5-14(13(2)8-12)6-7-18(21)20-16-9-15(19(22)23)10-17(11-16)26(3,24)25/h4-5,8-11H,6-7H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | GQHMQVDURGARTD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |