C15H15NO6S2 — CID 169371114
3-[(4-methylphenyl)sulfonylamino]-5-methylsulfonylbenzoic acid (PubChem CID 169371114) has the molecular formula C15H15NO6S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 169371114 |
| Molecular Formula | C15H15NO6S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-5-methylsulfonylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(=O)O)cc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C15H15NO6S2/c1-10-3-5-13(6-4-10)24(21,22)16-12-7-11(15(17)18)8-14(9-12)23(2,19)20/h3-9,16H,1-2H3,(H,17,18) |
| InChIKey | VGKUQTGAOCMLPX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |