C12H11NO7S2 — CID 154743275
3-(furan-3-ylsulfonylamino)-5-methylsulfonylbenzoic acid (PubChem CID 154743275) has the molecular formula C12H11NO7S2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-(furan-3-ylsulfonylamino)-5-methylsulfonylbenzoic acid.
| Compound Name | 3-(furan-3-ylsulfonylamino)-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 154743275 |
| Molecular Formula | C12H11NO7S2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 3-(furan-3-ylsulfonylamino)-5-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1cc(NS(=O)(=O)c2ccoc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H11NO7S2/c1-21(16,17)11-5-8(12(14)15)4-9(6-11)13-22(18,19)10-2-3-20-7-10/h2-7,13H,1H3,(H,14,15) |
| InChIKey | BNYPKVDZLBMCDY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |