C42H28N4O24S4 — CID 57015804
5-[[4,5,7-tris[(3,5-dicarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,3-dicarboxylic acid (PubChem CID 57015804) has the molecular formula C42H28N4O24S4 and a molecular weight of 1100.96 g/mol. Its IUPAC name is 5-[[4,5,7-tris[(3,5-dicarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4,5,7-tris[(3,5-dicarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 57015804 |
| Molecular Formula | C42H28N4O24S4 |
| Molecular Weight | 1100.96 g/mol |
| Exact Mass | 1100.00 |
| IUPAC Name | 5-[[4,5,7-tris[(3,5-dicarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2cc(S(=O)(=O)Nc3cc(C(=O)O)cc(C(=O)O)c3)c3c(S(=O)(=O)Nc4cc(C(=O)O)cc(C(=O)O)c4)cc(S(=O)(=O)Nc4cc(C(=O)O)cc(C(=O)O)c4)cc3c2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C42H28N4O24S4/c47-35(48)18-1-19(36(49)50)6-26(5-18)43-71(63,64)30-13-17-14-31(72(65,66)44-27-7-20(37(51)52)2-21(8-27)38(53)54)16-33(74(69,70)46-29-11-24(41(59)60)4-25(12-29)42(61)62)34(17)32(15-30)73(67,68)45-28-9-22(39(55)56)3-23(10-28)40(57)58/h1-16,43-46H,(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62) |
| InChIKey | KTIFEQLXJXQZGL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 483.08 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1100.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |