C28H22ClN3O24S9 — CID 54292180
5-[[4-chloro-5,7-bis[(3,5-disulfophenyl)sulfamoyl]naphthalen-1-yl]sulfonylamino]benzene-1,3-disulfonic acid (PubChem CID 54292180) has the molecular formula C28H22ClN3O24S9 and a molecular weight of 1108.54 g/mol. Its IUPAC name is 5-[[4-chloro-5,7-bis[(3,5-disulfophenyl)sulfamoyl]naphthalen-1-yl]sulfonylamino]benzene-1,3-disulfonic acid.
| Compound Name | 5-[[4-chloro-5,7-bis[(3,5-disulfophenyl)sulfamoyl]naphthalen-1-yl]sulfonylamino]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 54292180 |
| Molecular Formula | C28H22ClN3O24S9 |
| Molecular Weight | 1108.54 g/mol |
| Exact Mass | 1106.78 |
| IUPAC Name | 5-[[4-chloro-5,7-bis[(3,5-disulfophenyl)sulfamoyl]naphthalen-1-yl]sulfonylamino]benzene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(NS(=O)(=O)c2cc(S(=O)(=O)Nc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3)c3c(Cl)ccc(S(=O)(=O)Nc4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c4)c3c2)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H22ClN3O24S9/c29-25-1-2-26(58(35,36)31-15-5-20(62(45,46)47)10-21(6-15)63(48,49)50)24-12-17(57(33,34)30-14-3-18(60(39,40)41)9-19(4-14)61(42,43)44)13-27(28(24)25)59(37,38)32-16-7-22(64(51,52)53)11-23(8-16)65(54,55)56/h1-13,30-32H,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50)(H,51,52,53)(H,54,55,56) |
| InChIKey | RYHAFVQTMGEHAY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 464.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.54 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|