C22H12Cl6N2O5S2 — CID 86634480
7-hydroxy-1-N,3-N-bis(3,4,5-trichlorophenyl)naphthalene-1,3-disulfonamide (PubChem CID 86634480) has the molecular formula C22H12Cl6N2O5S2 and a molecular weight of 661.20 g/mol. Its IUPAC name is 7-hydroxy-1-N,3-N-bis(3,4,5-trichlorophenyl)naphthalene-1,3-disulfonamide.
| Compound Name | 7-hydroxy-1-N,3-N-bis(3,4,5-trichlorophenyl)naphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 86634480 |
| Molecular Formula | C22H12Cl6N2O5S2 |
| Molecular Weight | 661.20 g/mol |
| Exact Mass | 657.83 |
| IUPAC Name | 7-hydroxy-1-N,3-N-bis(3,4,5-trichlorophenyl)naphthalene-1,3-disulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(Cl)c(Cl)c1)c1cc(S(=O)(=O)Nc2cc(Cl)c(Cl)c(Cl)c2)c2cc(O)ccc2c1 |
| InChI | InChI=1S/C22H12Cl6N2O5S2/c23-16-4-11(5-17(24)21(16)27)29-36(32,33)14-3-10-1-2-13(31)8-15(10)20(9-14)37(34,35)30-12-6-18(25)22(28)19(26)7-12/h1-9,29-31H |
| InChIKey | HUTLLJJMLPMYSC-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.20 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|