C22H14Cl2F2N2O5S2 — CID 86634483
1-N,3-N-bis(3-chloro-2-fluorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide (PubChem CID 86634483) has the molecular formula C22H14Cl2F2N2O5S2 and a molecular weight of 559.40 g/mol. Its IUPAC name is 1-N,3-N-bis(3-chloro-2-fluorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide.
| Compound Name | 1-N,3-N-bis(3-chloro-2-fluorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 86634483 |
| Molecular Formula | C22H14Cl2F2N2O5S2 |
| Molecular Weight | 559.40 g/mol |
| Exact Mass | 557.97 |
| IUPAC Name | 1-N,3-N-bis(3-chloro-2-fluorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1F)c1cc(S(=O)(=O)Nc2cccc(Cl)c2F)c2cc(O)ccc2c1 |
| InChI | InChI=1S/C22H14Cl2F2N2O5S2/c23-16-3-1-5-18(21(16)25)27-34(30,31)14-9-12-7-8-13(29)10-15(12)20(11-14)35(32,33)28-19-6-2-4-17(24)22(19)26/h1-11,27-29H |
| InChIKey | JHYNSSACTRKFEG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |