C24H22N2O5S2 — CID 86634474
7-hydroxy-1-N,3-N-bis(3-methylphenyl)naphthalene-1,3-disulfonamide (PubChem CID 86634474) has the molecular formula C24H22N2O5S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 7-hydroxy-1-N,3-N-bis(3-methylphenyl)naphthalene-1,3-disulfonamide.
| Compound Name | 7-hydroxy-1-N,3-N-bis(3-methylphenyl)naphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 86634474 |
| Molecular Formula | C24H22N2O5S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 7-hydroxy-1-N,3-N-bis(3-methylphenyl)naphthalene-1,3-disulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(S(=O)(=O)Nc3cccc(C)c3)c3cc(O)ccc3c2)c1 |
| InChI | InChI=1S/C24H22N2O5S2/c1-16-5-3-7-19(11-16)25-32(28,29)22-13-18-9-10-21(27)14-23(18)24(15-22)33(30,31)26-20-8-4-6-17(2)12-20/h3-15,25-27H,1-2H3 |
| InChIKey | DBGQCUZYCAMMNX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |