C17H10Cl3NO3S — CID 87200093
3,5-dichloro-N-(5-chloro-6-formylnaphthalen-2-yl)benzenesulfonamide (PubChem CID 87200093) has the molecular formula C17H10Cl3NO3S and a molecular weight of 414.70 g/mol. Its IUPAC name is 3,5-dichloro-N-(5-chloro-6-formylnaphthalen-2-yl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(5-chloro-6-formylnaphthalen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 87200093 |
| Molecular Formula | C17H10Cl3NO3S |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 3,5-dichloro-N-(5-chloro-6-formylnaphthalen-2-yl)benzenesulfonamide |
| SMILES | O=Cc1ccc2cc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc2c1Cl |
| InChI | InChI=1S/C17H10Cl3NO3S/c18-12-6-13(19)8-15(7-12)25(23,24)21-14-3-4-16-10(5-14)1-2-11(9-22)17(16)20/h1-9,21H |
| InChIKey | MPAJXLNJSUCNHW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|