C15H10Cl2N2O3S — CID 145476758
3,5-dichloro-N-(2-formyl-1H-indol-5-yl)benzenesulfonamide (PubChem CID 145476758) has the molecular formula C15H10Cl2N2O3S and a molecular weight of 369.23 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-formyl-1H-indol-5-yl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(2-formyl-1H-indol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 145476758 |
| Molecular Formula | C15H10Cl2N2O3S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 3,5-dichloro-N-(2-formyl-1H-indol-5-yl)benzenesulfonamide |
| SMILES | O=Cc1cc2cc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc2[nH]1 |
| InChI | InChI=1S/C15H10Cl2N2O3S/c16-10-5-11(17)7-14(6-10)23(21,22)19-12-1-2-15-9(3-12)4-13(8-20)18-15/h1-8,18-19H |
| InChIKey | GGHWZWOIQSBITI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|