C15H12Cl2N2O2S — CID 59276788
3,5-dichloro-N-(3-methyl-1H-indol-5-yl)benzenesulfonamide (PubChem CID 59276788) has the molecular formula C15H12Cl2N2O2S and a molecular weight of 355.25 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-methyl-1H-indol-5-yl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(3-methyl-1H-indol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 59276788 |
| Molecular Formula | C15H12Cl2N2O2S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3,5-dichloro-N-(3-methyl-1H-indol-5-yl)benzenesulfonamide |
| SMILES | Cc1c[nH]c2ccc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)cc12 |
| InChI | InChI=1S/C15H12Cl2N2O2S/c1-9-8-18-15-3-2-12(7-14(9)15)19-22(20,21)13-5-10(16)4-11(17)6-13/h2-8,18-19H,1H3 |
| InChIKey | HSAJGWCSONOXEQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |