C20H16Cl2N2O4S — CID 58496720
6-[(3,5-dichlorophenyl)sulfonylamino]-N-(2-oxopropyl)naphthalene-2-carboxamide (PubChem CID 58496720) has the molecular formula C20H16Cl2N2O4S and a molecular weight of 451.33 g/mol. Its IUPAC name is 6-[(3,5-dichlorophenyl)sulfonylamino]-N-(2-oxopropyl)naphthalene-2-carboxamide.
| Compound Name | 6-[(3,5-dichlorophenyl)sulfonylamino]-N-(2-oxopropyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58496720 |
| Molecular Formula | C20H16Cl2N2O4S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 6-[(3,5-dichlorophenyl)sulfonylamino]-N-(2-oxopropyl)naphthalene-2-carboxamide |
| SMILES | CC(=O)CNC(=O)c1ccc2cc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc2c1 |
| InChI | InChI=1S/C20H16Cl2N2O4S/c1-12(25)11-23-20(26)15-3-2-14-7-18(5-4-13(14)6-15)24-29(27,28)19-9-16(21)8-17(22)10-19/h2-10,24H,11H2,1H3,(H,23,26) |
| InChIKey | YMRVNNVNLIQCPP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |