C19H17NO4S — CID 58497045
6-[(3,5-dimethylphenyl)sulfonylamino]naphthalene-2-carboxylic acid (PubChem CID 58497045) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 6-[(3,5-dimethylphenyl)sulfonylamino]naphthalene-2-carboxylic acid.
| Compound Name | 6-[(3,5-dimethylphenyl)sulfonylamino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58497045 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 6-[(3,5-dimethylphenyl)sulfonylamino]naphthalene-2-carboxylic acid |
| SMILES | Cc1cc(C)cc(S(=O)(=O)Nc2ccc3cc(C(=O)O)ccc3c2)c1 |
| InChI | InChI=1S/C19H17NO4S/c1-12-7-13(2)9-18(8-12)25(23,24)20-17-6-5-14-10-16(19(21)22)4-3-15(14)11-17/h3-11,20H,1-2H3,(H,21,22) |
| InChIKey | HDPXQAHPMZUXMQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |