C46H28N4O32S4 — CID 54405155
5-[[4,6,8-tris[(3,4,5-tricarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,2,3-tricarboxylic acid (PubChem CID 54405155) has the molecular formula C46H28N4O32S4 and a molecular weight of 1276.99 g/mol. Its IUPAC name is 5-[[4,6,8-tris[(3,4,5-tricarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,2,3-tricarboxylic acid.
| Compound Name | 5-[[4,6,8-tris[(3,4,5-tricarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 54405155 |
| Molecular Formula | C46H28N4O32S4 |
| Molecular Weight | 1276.99 g/mol |
| Exact Mass | 1275.96 |
| IUPAC Name | 5-[[4,6,8-tris[(3,4,5-tricarboxyphenyl)sulfamoyl]naphthalen-2-yl]sulfonylamino]benzene-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2cc(S(=O)(=O)Nc3cc(C(=O)O)c(C(=O)O)c(C(=O)O)c3)c3cc(S(=O)(=O)Nc4cc(C(=O)O)c(C(=O)O)c(C(=O)O)c4)cc(S(=O)(=O)Nc4cc(C(=O)O)c(C(=O)O)c(C(=O)O)c4)c3c2)cc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C46H28N4O32S4/c51-35(52)21-1-13(2-22(36(53)54)31(21)43(67)68)47-83(75,76)17-9-19-20(29(11-17)85(79,80)49-15-5-25(39(59)60)33(45(71)72)26(6-15)40(61)62)10-18(84(77,78)48-14-3-23(37(55)56)32(44(69)70)24(4-14)38(57)58)12-30(19)86(81,82)50-16-7-27(41(63)64)34(46(73)74)28(8-16)42(65)66/h1-12,47-50H,(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62)(H,63,64)(H,65,66)(H,67,68)(H,69,70)(H,71,72)(H,73,74) |
| InChIKey | VQEFCDNFNSYROO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 632.28 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1276.99 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 20 |