C27H20Cl2N2O10S2 — CID 25230991
3-[[3-carboxy-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxyphenyl]methyl]-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 25230991) has the molecular formula C27H20Cl2N2O10S2 and a molecular weight of 667.50 g/mol. Its IUPAC name is 3-[[3-carboxy-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxyphenyl]methyl]-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 3-[[3-carboxy-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxyphenyl]methyl]-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 25230991 |
| Molecular Formula | C27H20Cl2N2O10S2 |
| Molecular Weight | 667.50 g/mol |
| Exact Mass | 665.99 |
| IUPAC Name | 3-[[3-carboxy-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxyphenyl]methyl]-5-[(4-chlorophenyl)sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccc(Cl)cc2)cc(Cc2cc(NS(=O)(=O)c3ccc(Cl)cc3)cc(C(=O)O)c2O)c1O |
| InChI | InChI=1S/C27H20Cl2N2O10S2/c28-16-1-5-20(6-2-16)42(38,39)30-18-10-14(24(32)22(12-18)26(34)35)9-15-11-19(13-23(25(15)33)27(36)37)31-43(40,41)21-7-3-17(29)4-8-21/h1-8,10-13,30-33H,9H2,(H,34,35)(H,36,37) |
| InChIKey | JDQMAOXSPMBZPX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|