C37H42N2O10S2 — CID 25230924
methyl 5-[(4-tert-butylphenyl)sulfonylamino]-3-[[5-[(4-tert-butylphenyl)sulfonylamino]-2-hydroxy-3-methoxycarbonylphenyl]methyl]-2-hydroxybenzoate (PubChem CID 25230924) has the molecular formula C37H42N2O10S2 and a molecular weight of 738.88 g/mol. Its IUPAC name is methyl 5-[(4-tert-butylphenyl)sulfonylamino]-3-[[5-[(4-tert-butylphenyl)sulfonylamino]-2-hydroxy-3-methoxycarbonylphenyl]methyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[(4-tert-butylphenyl)sulfonylamino]-3-[[5-[(4-tert-butylphenyl)sulfonylamino]-2-hydroxy-3-methoxycarbonylphenyl]methyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 25230924 |
| Molecular Formula | C37H42N2O10S2 |
| Molecular Weight | 738.88 g/mol |
| Exact Mass | 738.23 |
| IUPAC Name | methyl 5-[(4-tert-butylphenyl)sulfonylamino]-3-[[5-[(4-tert-butylphenyl)sulfonylamino]-2-hydroxy-3-methoxycarbonylphenyl]methyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc(Cc2cc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc(C(=O)OC)c2O)c1O |
| InChI | InChI=1S/C37H42N2O10S2/c1-36(2,3)24-9-13-28(14-10-24)50(44,45)38-26-18-22(32(40)30(20-26)34(42)48-7)17-23-19-27(21-31(33(23)41)35(43)49-8)39-51(46,47)29-15-11-25(12-16-29)37(4,5)6/h9-16,18-21,38-41H,17H2,1-8H3 |
| InChIKey | LHOOROKJUDEBQQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.88 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|