C13H14Cl2N2O5S2 — CID 21401196
4-[(4-amino-2,5-dichlorophenyl)sulfonylamino]benzenesulfonic acid;methane (PubChem CID 21401196) has the molecular formula C13H14Cl2N2O5S2 and a molecular weight of 413.30 g/mol. Its IUPAC name is 4-[(4-amino-2,5-dichlorophenyl)sulfonylamino]benzenesulfonic acid;methane.
| Compound Name | 4-[(4-amino-2,5-dichlorophenyl)sulfonylamino]benzenesulfonic acid;methane |
|---|---|
| PubChem CID | 21401196 |
| Molecular Formula | C13H14Cl2N2O5S2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 4-[(4-amino-2,5-dichlorophenyl)sulfonylamino]benzenesulfonic acid;methane |
| SMILES | C.Nc1cc(Cl)c(S(=O)(=O)Nc2ccc(S(=O)(=O)O)cc2)cc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O5S2.CH4/c13-9-6-12(10(14)5-11(9)15)22(17,18)16-7-1-3-8(4-2-7)23(19,20)21;/h1-6,16H,15H2,(H,19,20,21);1H4 |
| InChIKey | QHVPGJWDCSIALB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|