C11H11NO9S3 — CID 19366275
5-hydroxy-4-(methanesulfonamido)naphthalene-1,7-disulfonic acid (PubChem CID 19366275) has the molecular formula C11H11NO9S3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 5-hydroxy-4-(methanesulfonamido)naphthalene-1,7-disulfonic acid.
| Compound Name | 5-hydroxy-4-(methanesulfonamido)naphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 19366275 |
| Molecular Formula | C11H11NO9S3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 5-hydroxy-4-(methanesulfonamido)naphthalene-1,7-disulfonic acid |
| SMILES | CS(=O)(=O)Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C11H11NO9S3/c1-22(14,15)12-8-2-3-10(24(19,20)21)7-4-6(23(16,17)18)5-9(13)11(7)8/h2-5,12-13H,1H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | IBKDXQVLVZFCFQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|