C11H11NO6S2 — CID 71330282
4-hydroxy-5-(methanesulfonamido)naphthalene-2-sulfonic acid (PubChem CID 71330282) has the molecular formula C11H11NO6S2 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-hydroxy-5-(methanesulfonamido)naphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-5-(methanesulfonamido)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 71330282 |
| Molecular Formula | C11H11NO6S2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 4-hydroxy-5-(methanesulfonamido)naphthalene-2-sulfonic acid |
| SMILES | CS(=O)(=O)Nc1cccc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C11H11NO6S2/c1-19(14,15)12-9-4-2-3-7-5-8(20(16,17)18)6-10(13)11(7)9/h2-6,12-13H,1H3,(H,16,17,18) |
| InChIKey | USGLJFDFJIFVHN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|