C12H13NO7S2 — CID 23320334
4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 23320334) has the molecular formula C12H13NO7S2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 23320334 |
| Molecular Formula | C12H13NO7S2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CCNc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C12H13NO7S2/c1-2-13-10-5-8(21(15,16)17)3-7-4-9(22(18,19)20)6-11(14)12(7)10/h3-6,13-14H,2H2,1H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | TXNPVSSOCHOJMY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|