4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid

C12H13NO7S2 — CID 23320334

IUPAC4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid
SMILESCCNc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12
InChIInChI=1S/C12H13NO7S2/c1-2-13-10-5-8(21(15,16)17)3-7-4-9(22(18,19)20)6-11(14)12(7)10/h3-6,13-14H,2H2,1H3,(H,15,16,17)(H,18,19,20)
InChIKeyTXNPVSSOCHOJMY-UHFFFAOYSA-N
MW347.37 g/mol
LogP1.47
Rot. Bonds4

About 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid

4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 23320334) has the molecular formula C12H13NO7S2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid.

Molecular Properties

Compound Name4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid
PubChem CID23320334
Molecular FormulaC12H13NO7S2
Molecular Weight347.37 g/mol
Exact Mass347.01
IUPAC Name4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid
SMILESCCNc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12
InChIInChI=1S/C12H13NO7S2/c1-2-13-10-5-8(21(15,16)17)3-7-4-9(22(18,19)20)6-11(14)12(7)10/h3-6,13-14H,2H2,1H3,(H,15,16,17)(H,18,19,20)
InChIKeyTXNPVSSOCHOJMY-UHFFFAOYSA-N
XLogP1.47
TPSA141.00 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.37
LogP ≤ 51.47
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid?
The IUPAC name of 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid (CID 23320334) is 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid.
What is the SMILES notation for 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid?
The canonical SMILES for 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid is CCNc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12.
What is the InChIKey of 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid?
The InChIKey is TXNPVSSOCHOJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO7S2/c1-2-13-10-5-8(21(15,16)17)3-7-4-9(22(18,19)20)6-11(14)12(7)10/h3-6,13-14H,2H2,1H3,(H,15,16,17)(H,18,19,20).
What are the key properties of 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid?
4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid has a molecular weight of 347.37 g/mol, XLogP of 1.47, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid is sourced from PubChem (CID 23320334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).