C18H14N2O10S2 — CID 23335900
3-amino-5-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]benzoic acid (PubChem CID 23335900) has the molecular formula C18H14N2O10S2 and a molecular weight of 482.45 g/mol. Its IUPAC name is 3-amino-5-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]benzoic acid.
| Compound Name | 3-amino-5-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 23335900 |
| Molecular Formula | C18H14N2O10S2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 3-amino-5-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]benzoic acid |
| SMILES | Nc1cc(C(=O)O)cc(C(=O)Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c23)c1 |
| InChI | InChI=1S/C18H14N2O10S2/c19-11-2-9(1-10(3-11)18(23)24)17(22)20-14-6-12(31(25,26)27)4-8-5-13(32(28,29)30)7-15(21)16(8)14/h1-7,21H,19H2,(H,20,22)(H,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | CCWSRFPRPBZHAU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 221.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|