C17H13NO9S2 — CID 102295742
4-hydroxy-5-[(2-hydroxybenzoyl)amino]naphthalene-2,7-disulfonic acid (PubChem CID 102295742) has the molecular formula C17H13NO9S2 and a molecular weight of 439.42 g/mol. Its IUPAC name is 4-hydroxy-5-[(2-hydroxybenzoyl)amino]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-5-[(2-hydroxybenzoyl)amino]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 102295742 |
| Molecular Formula | C17H13NO9S2 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | 4-hydroxy-5-[(2-hydroxybenzoyl)amino]naphthalene-2,7-disulfonic acid |
| SMILES | O=C(Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12)c1ccccc1O |
| InChI | InChI=1S/C17H13NO9S2/c19-14-4-2-1-3-12(14)17(21)18-13-7-10(28(22,23)24)5-9-6-11(29(25,26)27)8-15(20)16(9)13/h1-8,19-20H,(H,18,21)(H,22,23,24)(H,25,26,27) |
| InChIKey | BYRJNDUMOYTLRT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|