C15H11F4NO8S2 — CID 154147612
4-hydroxy-5-[(2,2,3,3-tetrafluorocyclobutanecarbonyl)amino]naphthalene-2,7-disulfonic acid (PubChem CID 154147612) has the molecular formula C15H11F4NO8S2 and a molecular weight of 473.38 g/mol. Its IUPAC name is 4-hydroxy-5-[(2,2,3,3-tetrafluorocyclobutanecarbonyl)amino]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-5-[(2,2,3,3-tetrafluorocyclobutanecarbonyl)amino]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 154147612 |
| Molecular Formula | C15H11F4NO8S2 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 4-hydroxy-5-[(2,2,3,3-tetrafluorocyclobutanecarbonyl)amino]naphthalene-2,7-disulfonic acid |
| SMILES | O=C(Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12)C1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C15H11F4NO8S2/c16-14(17)5-9(15(14,18)19)13(22)20-10-3-7(29(23,24)25)1-6-2-8(30(26,27)28)4-11(21)12(6)10/h1-4,9,21H,5H2,(H,20,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | XKALWCSPPMXHSG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|