C19H23NO7S2 — CID 163568574
4-hydroxy-5-[1-(4-methylcyclohexyl)ethenylamino]naphthalene-2,7-disulfonic acid (PubChem CID 163568574) has the molecular formula C19H23NO7S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-hydroxy-5-[1-(4-methylcyclohexyl)ethenylamino]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-5-[1-(4-methylcyclohexyl)ethenylamino]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 163568574 |
| Molecular Formula | C19H23NO7S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 4-hydroxy-5-[1-(4-methylcyclohexyl)ethenylamino]naphthalene-2,7-disulfonic acid |
| SMILES | C=C(Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12)C1CCC(C)CC1 |
| InChI | InChI=1S/C19H23NO7S2/c1-11-3-5-13(6-4-11)12(2)20-17-9-15(28(22,23)24)7-14-8-16(29(25,26)27)10-18(21)19(14)17/h7-11,13,20-21H,2-6H2,1H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | FXGXKGMCACGHII-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|