C18H14N2O10S2 — CID 57198974
4-hydroxy-5-[(2-methyl-4-nitrobenzoyl)amino]naphthalene-2,7-disulfonic acid (PubChem CID 57198974) has the molecular formula C18H14N2O10S2 and a molecular weight of 482.45 g/mol. Its IUPAC name is 4-hydroxy-5-[(2-methyl-4-nitrobenzoyl)amino]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-5-[(2-methyl-4-nitrobenzoyl)amino]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 57198974 |
| Molecular Formula | C18H14N2O10S2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 4-hydroxy-5-[(2-methyl-4-nitrobenzoyl)amino]naphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C18H14N2O10S2/c1-9-4-11(20(23)24)2-3-14(9)18(22)19-15-7-12(31(25,26)27)5-10-6-13(32(28,29)30)8-16(21)17(10)15/h2-8,21H,1H3,(H,19,22)(H,25,26,27)(H,28,29,30) |
| InChIKey | CYWIXSBYORNCOY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 201.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|