C16H12N2O9S2 — CID 23465233
4-hydroxy-5-(4-nitroanilino)naphthalene-2,7-disulfonic acid (PubChem CID 23465233) has the molecular formula C16H12N2O9S2 and a molecular weight of 440.41 g/mol. Its IUPAC name is 4-hydroxy-5-(4-nitroanilino)naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-5-(4-nitroanilino)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 23465233 |
| Molecular Formula | C16H12N2O9S2 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 4-hydroxy-5-(4-nitroanilino)naphthalene-2,7-disulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c23)cc1 |
| InChI | InChI=1S/C16H12N2O9S2/c19-15-8-13(29(25,26)27)6-9-5-12(28(22,23)24)7-14(16(9)15)17-10-1-3-11(4-2-10)18(20)21/h1-8,17,19H,(H,22,23,24)(H,25,26,27) |
| InChIKey | DRTQSAZPZOYFQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 184.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|