C40H28N10O19S4 — CID 165363378
4-[[2,4-dihydroxy-3,5-bis[[4-(4-nitro-2-sulfoanilino)phenyl]diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 165363378) has the molecular formula C40H28N10O19S4 and a molecular weight of 1080.98 g/mol. Its IUPAC name is 4-[[2,4-dihydroxy-3,5-bis[[4-(4-nitro-2-sulfoanilino)phenyl]diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[2,4-dihydroxy-3,5-bis[[4-(4-nitro-2-sulfoanilino)phenyl]diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 165363378 |
| Molecular Formula | C40H28N10O19S4 |
| Molecular Weight | 1080.98 g/mol |
| Exact Mass | 1080.04 |
| IUPAC Name | 4-[[2,4-dihydroxy-3,5-bis[[4-(4-nitro-2-sulfoanilino)phenyl]diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc(/N=N/c3cc(/N=N/c4cc(S(=O)(=O)O)cc5cc(S(=O)(=O)O)cc(O)c45)c(O)c(/N=N/c4ccc(Nc5ccc([N+](=O)[O-])cc5S(=O)(=O)O)cc4)c3O)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C40H28N10O19S4/c51-34-18-28(71(61,62)63)14-20-13-27(70(58,59)60)17-31(37(20)34)45-47-33-19-32(46-43-23-5-1-21(2-6-23)41-29-11-9-25(49(54)55)15-35(29)72(64,65)66)39(52)38(40(33)53)48-44-24-7-3-22(4-8-24)42-30-12-10-26(50(56)57)16-36(30)73(67,68)69/h1-19,41-42,51-53H,(H,58,59,60)(H,61,62,63)(H,64,65,66)(H,67,68,69)/b46-43+,47-45+,48-44+ |
| InChIKey | YQIYMJRNCXXGQC-PZNNWFDPSA-N |
| XLogP | 9.49 |
| TPSA | 462.67 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 73 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.98 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|