About 2-(4-nitroanilino)phenol
2-(4-nitroanilino)phenol (PubChem CID 14224817) has the molecular formula C12H10N2O3
and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-(4-nitroanilino)phenol.
Molecular Properties
| Compound Name | 2-(4-nitroanilino)phenol |
| PubChem CID | 14224817 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(4-nitroanilino)phenol |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2O)cc1 |
| InChI | InChI=1S/C12H10N2O3/c15-12-4-2-1-3-11(12)13-9-5-7-10(8-6-9)14(16)17/h1-8,13,15H |
| InChIKey | PKSRFMRBEMCQHM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitroanilino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitroanilino)phenol?
The IUPAC name of 2-(4-nitroanilino)phenol (CID 14224817) is 2-(4-nitroanilino)phenol.
What is the SMILES notation for 2-(4-nitroanilino)phenol?
The canonical SMILES for 2-(4-nitroanilino)phenol is O=[N+]([O-])c1ccc(Nc2ccccc2O)cc1.
What is the InChIKey of 2-(4-nitroanilino)phenol?
The InChIKey is PKSRFMRBEMCQHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3/c15-12-4-2-1-3-11(12)13-9-5-7-10(8-6-9)14(16)17/h1-8,13,15H.
What are the key properties of 2-(4-nitroanilino)phenol?
2-(4-nitroanilino)phenol has a molecular weight of 230.22 g/mol, XLogP of 3.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitroanilino)phenol is sourced from PubChem (CID 14224817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).