C21H17N7O2 — CID 71593523
2-N-(4-nitrophenyl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 71593523) has the molecular formula C21H17N7O2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-N-(4-nitrophenyl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-nitrophenyl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 71593523 |
| Molecular Formula | C21H17N7O2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-N-(4-nitrophenyl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H17N7O2/c29-28(30)18-13-11-17(12-14-18)24-21-26-19(22-15-7-3-1-4-8-15)25-20(27-21)23-16-9-5-2-6-10-16/h1-14H,(H3,22,23,24,25,26,27) |
| InChIKey | IDNKKFXACABELF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|