C15H12N6O3 — CID 86206737
6-anilino-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one (PubChem CID 86206737) has the molecular formula C15H12N6O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is 6-anilino-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one.
| Compound Name | 6-anilino-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 86206737 |
| Molecular Formula | C15H12N6O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 6-anilino-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(Nc2ccc([N+](=O)[O-])cc2)nc(Nc2ccccc2)[nH]1 |
| InChI | InChI=1S/C15H12N6O3/c22-15-19-13(16-10-4-2-1-3-5-10)18-14(20-15)17-11-6-8-12(9-7-11)21(23)24/h1-9H,(H3,16,17,18,19,20,22) |
| InChIKey | JNFCFRCRACBBPP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|