C17H13N5O5 — CID 136716664
3-[[4-(3-carboxyanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 136716664) has the molecular formula C17H13N5O5 and a molecular weight of 367.32 g/mol. Its IUPAC name is 3-[[4-(3-carboxyanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-(3-carboxyanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 136716664 |
| Molecular Formula | C17H13N5O5 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3-[[4-(3-carboxyanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nc(Nc3cccc(C(=O)O)c3)[nH]c(=O)n2)c1 |
| InChI | InChI=1S/C17H13N5O5/c23-13(24)9-3-1-5-11(7-9)18-15-20-16(22-17(27)21-15)19-12-6-2-4-10(8-12)14(25)26/h1-8H,(H,23,24)(H,25,26)(H3,18,19,20,21,22,27) |
| InChIKey | RONHWKINEVNZIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |