C10H8N4O4 — CID 146541131
3-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzoic acid (PubChem CID 146541131) has the molecular formula C10H8N4O4 and a molecular weight of 248.20 g/mol. Its IUPAC name is 3-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzoic acid.
| Compound Name | 3-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 146541131 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nc(=O)[nH]c(=O)[nH]2)c1 |
| InChI | InChI=1S/C10H8N4O4/c15-7(16)5-2-1-3-6(4-5)11-8-12-9(17)14-10(18)13-8/h1-4H,(H,15,16)(H3,11,12,13,14,17,18) |
| InChIKey | UMJAYCPEGZBXDV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |