C9H9AsN4O5 — CID 24833865
[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid (PubChem CID 24833865) has the molecular formula C9H9AsN4O5 and a molecular weight of 328.12 g/mol. Its IUPAC name is [4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid.
| Compound Name | [4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid |
|---|---|
| PubChem CID | 24833865 |
| Molecular Formula | C9H9AsN4O5 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | [4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid |
| SMILES | O=c1nc(Nc2ccc([As](=O)(O)O)cc2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H9AsN4O5/c15-8-12-7(13-9(16)14-8)11-6-3-1-5(2-4-6)10(17,18)19/h1-4H,(H2,17,18,19)(H3,11,12,13,14,15,16) |
| InChIKey | JSMGOWJQYQTJOH-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 148.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|