C9H8N4O2 — CID 30399
6-anilino-1H-1,3,5-triazine-2,4-dione (PubChem CID 30399) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 6-anilino-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-anilino-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 30399 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 6-anilino-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(Nc2ccccc2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H8N4O2/c14-8-11-7(12-9(15)13-8)10-6-4-2-1-3-5-6/h1-5H,(H3,10,11,12,13,14,15) |
| InChIKey | VUIKYRBPWMVBKY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |